C15H23N3O4S2 — CID 133115583
(3aR,6aR)-2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-5-ethylsulfonyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 133115583) has the molecular formula C15H23N3O4S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is (3aR,6aR)-2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-5-ethylsulfonyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-5-ethylsulfonyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 133115583 |
| Molecular Formula | C15H23N3O4S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (3aR,6aR)-2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-5-ethylsulfonyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CCS(=O)(=O)N1C[C@H]2CN(Cc3nc(C)c(C)s3)C[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C15H23N3O4S2/c1-4-24(21,22)18-6-12-5-17(8-15(12,9-18)14(19)20)7-13-16-10(2)11(3)23-13/h12H,4-9H2,1-3H3,(H,19,20)/t12-,15-/m1/s1 |
| InChIKey | XANKIDRGTDPJLM-IUODEOHRSA-N |
| XLogP | 0.93 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |