C14H20N4O2 — CID 133127959
(3aR,6aR)-2-methyl-5-[(3-methylpyrazin-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 133127959) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is (3aR,6aR)-2-methyl-5-[(3-methylpyrazin-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-2-methyl-5-[(3-methylpyrazin-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 133127959 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (3aR,6aR)-2-methyl-5-[(3-methylpyrazin-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1nccnc1CN1C[C@H]2CN(C)C[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C14H20N4O2/c1-10-12(16-4-3-15-10)7-18-6-11-5-17(2)8-14(11,9-18)13(19)20/h3-4,11H,5-9H2,1-2H3,(H,19,20)/t11-,14-/m1/s1 |
| InChIKey | AZZWSQFNPDVUDC-BXUZGUMPSA-N |
| XLogP | 0.23 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |