C13H16ClN3O2 — CID 133116219
6-[(3aR,6aR)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-5-chloropyridine-3-carboxylic acid (PubChem CID 133116219) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 6-[(3aR,6aR)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-5-chloropyridine-3-carboxylic acid.
| Compound Name | 6-[(3aR,6aR)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-5-chloropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 133116219 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 6-[(3aR,6aR)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-5-chloropyridine-3-carboxylic acid |
| SMILES | CN1CC[C@@H]2CN(c3ncc(C(=O)O)cc3Cl)C[C@@H]21 |
| InChI | InChI=1S/C13H16ClN3O2/c1-16-3-2-8-6-17(7-11(8)16)12-10(14)4-9(5-15-12)13(18)19/h4-5,8,11H,2-3,6-7H2,1H3,(H,18,19)/t8-,11+/m1/s1 |
| InChIKey | BPHYEQQOJTYHNT-KCJUWKMLSA-N |
| XLogP | 1.57 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |