About 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid
6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid (PubChem CID 133118952) has the molecular formula C14H15ClN2O4
and a molecular weight of 310.74 g/mol. Its IUPAC name is 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid |
| PubChem CID | 133118952 |
| Molecular Formula | C14H15ClN2O4 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2C[C@H](C(=O)O)[C@@H](C3CC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H15ClN2O4/c15-11-3-8(13(18)19)4-16-12(11)17-5-9(7-1-2-7)10(6-17)14(20)21/h3-4,7,9-10H,1-2,5-6H2,(H,18,19)(H,20,21)/t9-,10+/m1/s1 |
| InChIKey | QNYIQFOZFAPJTJ-ZJUUUORDSA-N |
| XLogP | 1.98 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid?
The IUPAC name of 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid (CID 133118952) is 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid.
What is the SMILES notation for 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid?
The canonical SMILES for 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid is O=C(O)c1cnc(N2C[C@H](C(=O)O)[C@@H](C3CC3)C2)c(Cl)c1.
What is the InChIKey of 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid?
The InChIKey is QNYIQFOZFAPJTJ-ZJUUUORDSA-N. The full InChI is InChI=1S/C14H15ClN2O4/c15-11-3-8(13(18)19)4-16-12(11)17-5-9(7-1-2-7)10(6-17)14(20)21/h3-4,7,9-10H,1-2,5-6H2,(H,18,19)(H,20,21)/t9-,10+/m1/s1.
What are the key properties of 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid?
6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid has a molecular weight of 310.74 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3R,4R)-3-carboxy-4-cyclopropylpyrrolidin-1-yl]-5-chloropyridine-3-carboxylic acid is sourced from PubChem (CID 133118952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).