C22H27N3OS — CID 133120512
[(2S,3S,6S)-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(2-propyl-1,3-thiazol-4-yl)methanone (PubChem CID 133120512) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is [(2S,3S,6S)-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(2-propyl-1,3-thiazol-4-yl)methanone.
| Compound Name | [(2S,3S,6S)-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(2-propyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 133120512 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [(2S,3S,6S)-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(2-propyl-1,3-thiazol-4-yl)methanone |
| SMILES | CCCc1nc(C(=O)N2C[C@H](c3ccccc3)[C@H]3[C@@H]2C2CCN3CC2)cs1 |
| InChI | InChI=1S/C22H27N3OS/c1-2-6-19-23-18(14-27-19)22(26)25-13-17(15-7-4-3-5-8-15)21-20(25)16-9-11-24(21)12-10-16/h3-5,7-8,14,16-17,20-21H,2,6,9-13H2,1H3/t17-,20+,21+/m1/s1 |
| InChIKey | PTAOKVUPTAGBFV-QMMLZNLJSA-N |
| XLogP | 3.80 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |