C17H21Cl2FN2O — CID 133121677
(1R,5S)-3-[(2,3-dichloro-6-fluorophenyl)methyl]-6-propyl-3,6-diazabicyclo[3.2.2]nonan-7-one (PubChem CID 133121677) has the molecular formula C17H21Cl2FN2O and a molecular weight of 359.27 g/mol. Its IUPAC name is (1R,5S)-3-[(2,3-dichloro-6-fluorophenyl)methyl]-6-propyl-3,6-diazabicyclo[3.2.2]nonan-7-one.
| Compound Name | (1R,5S)-3-[(2,3-dichloro-6-fluorophenyl)methyl]-6-propyl-3,6-diazabicyclo[3.2.2]nonan-7-one |
|---|---|
| PubChem CID | 133121677 |
| Molecular Formula | C17H21Cl2FN2O |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (1R,5S)-3-[(2,3-dichloro-6-fluorophenyl)methyl]-6-propyl-3,6-diazabicyclo[3.2.2]nonan-7-one |
| SMILES | CCCN1C(=O)[C@@H]2CC[C@H]1CN(Cc1c(F)ccc(Cl)c1Cl)C2 |
| InChI | InChI=1S/C17H21Cl2FN2O/c1-2-7-22-12-4-3-11(17(22)23)8-21(9-12)10-13-15(20)6-5-14(18)16(13)19/h5-6,11-12H,2-4,7-10H2,1H3/t11-,12+/m1/s1 |
| InChIKey | YWSCQMMMGSPSBD-NEPJUHHUSA-N |
| XLogP | 3.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|