C12H12Cl2FNO — CID 97273018
(5S)-1-[(2,3-dichloro-6-fluorophenyl)methyl]-5-methylpyrrolidin-2-one (PubChem CID 97273018) has the molecular formula C12H12Cl2FNO and a molecular weight of 276.14 g/mol. Its IUPAC name is (5S)-1-[(2,3-dichloro-6-fluorophenyl)methyl]-5-methylpyrrolidin-2-one.
| Compound Name | (5S)-1-[(2,3-dichloro-6-fluorophenyl)methyl]-5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 97273018 |
| Molecular Formula | C12H12Cl2FNO |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | (5S)-1-[(2,3-dichloro-6-fluorophenyl)methyl]-5-methylpyrrolidin-2-one |
| SMILES | C[C@H]1CCC(=O)N1Cc1c(F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C12H12Cl2FNO/c1-7-2-5-11(17)16(7)6-8-10(15)4-3-9(13)12(8)14/h3-4,7H,2,5-6H2,1H3/t7-/m0/s1 |
| InChIKey | UPQSQUMCDWNYSM-ZETCQYMHSA-N |
| XLogP | 3.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|