C11H11ClFNO — CID 91070786
1-(3-chloro-4-fluorophenyl)-5-methylpyrrolidin-2-one (PubChem CID 91070786) has the molecular formula C11H11ClFNO and a molecular weight of 227.67 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-5-methylpyrrolidin-2-one.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 91070786 |
| Molecular Formula | C11H11ClFNO |
| Molecular Weight | 227.67 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-5-methylpyrrolidin-2-one |
| SMILES | CC1CCC(=O)N1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C11H11ClFNO/c1-7-2-5-11(15)14(7)8-3-4-10(13)9(12)6-8/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | CJAKMLKZGMKHSZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.67 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |