C23H27N3O2 — CID 133122495
1-[(2S,3S,6S)-3-(4-methylphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione (PubChem CID 133122495) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[(2S,3S,6S)-3-(4-methylphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione.
| Compound Name | 1-[(2S,3S,6S)-3-(4-methylphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 133122495 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-[(2S,3S,6S)-3-(4-methylphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione |
| SMILES | Cc1ccc([C@H]2CN(C(=O)C(=O)c3cccn3C)[C@H]3C4CCN(CC4)[C@@H]23)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-15-5-7-16(8-6-15)18-14-26(20-17-9-12-25(13-10-17)21(18)20)23(28)22(27)19-4-3-11-24(19)2/h3-8,11,17-18,20-21H,9-10,12-14H2,1-2H3/t18-,20+,21+/m1/s1 |
| InChIKey | FQHZJPHLLHTBRM-GIVPXCGWSA-N |
| XLogP | 2.61 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|