C22H28N4O — CID 56888688
(2,5-dimethylpyrazol-3-yl)-[(2R,3S,6R)-3-(4-methylphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone (PubChem CID 56888688) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is (2,5-dimethylpyrazol-3-yl)-[(2R,3S,6R)-3-(4-methylphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone.
| Compound Name | (2,5-dimethylpyrazol-3-yl)-[(2R,3S,6R)-3-(4-methylphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone |
|---|---|
| PubChem CID | 56888688 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (2,5-dimethylpyrazol-3-yl)-[(2R,3S,6R)-3-(4-methylphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone |
| SMILES | Cc1ccc([C@H]2CN(C(=O)c3cc(C)nn3C)[C@@H]3C4CCN(CC4)[C@H]23)cc1 |
| InChI | InChI=1S/C22H28N4O/c1-14-4-6-16(7-5-14)18-13-26(22(27)19-12-15(2)23-24(19)3)20-17-8-10-25(11-9-17)21(18)20/h4-7,12,17-18,20-21H,8-11,13H2,1-3H3/t18-,20-,21-/m1/s1 |
| InChIKey | RSHVTVMSBXRNQE-HMXCVIKNSA-N |
| XLogP | 2.74 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |