C15H25N3O2S — CID 133124769
(3R,4R)-1-[(2-butylsulfanylpyrimidin-5-yl)methyl]-4-methylpiperidine-3,4-diol (PubChem CID 133124769) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is (3R,4R)-1-[(2-butylsulfanylpyrimidin-5-yl)methyl]-4-methylpiperidine-3,4-diol.
| Compound Name | (3R,4R)-1-[(2-butylsulfanylpyrimidin-5-yl)methyl]-4-methylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 133124769 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (3R,4R)-1-[(2-butylsulfanylpyrimidin-5-yl)methyl]-4-methylpiperidine-3,4-diol |
| SMILES | CCCCSc1ncc(CN2CC[C@@](C)(O)[C@H](O)C2)cn1 |
| InChI | InChI=1S/C15H25N3O2S/c1-3-4-7-21-14-16-8-12(9-17-14)10-18-6-5-15(2,20)13(19)11-18/h8-9,13,19-20H,3-7,10-11H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | YZPMKGFNLMDZIA-UKRRQHHQSA-N |
| XLogP | 1.69 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|