C18H26N2O3S2 — CID 133129289
3-benzylsulfanyl-1-[(1S,5S)-3-methylsulfonyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]propan-1-one (PubChem CID 133129289) has the molecular formula C18H26N2O3S2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-[(1S,5S)-3-methylsulfonyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]propan-1-one.
| Compound Name | 3-benzylsulfanyl-1-[(1S,5S)-3-methylsulfonyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]propan-1-one |
|---|---|
| PubChem CID | 133129289 |
| Molecular Formula | C18H26N2O3S2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 3-benzylsulfanyl-1-[(1S,5S)-3-methylsulfonyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]propan-1-one |
| SMILES | CS(=O)(=O)N1C[C@H]2CC[C@@H](C1)N(C(=O)CCSCc1ccccc1)C2 |
| InChI | InChI=1S/C18H26N2O3S2/c1-25(22,23)19-11-16-7-8-17(13-19)20(12-16)18(21)9-10-24-14-15-5-3-2-4-6-15/h2-6,16-17H,7-14H2,1H3/t16-,17+/m1/s1 |
| InChIKey | IBEOLPNVOJXATQ-SJORKVTESA-N |
| XLogP | 2.19 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|