C24H28N2O2 — CID 133134019
1-[(1R,5S)-3-benzoyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-4-phenylbutan-1-one (PubChem CID 133134019) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-[(1R,5S)-3-benzoyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[(1R,5S)-3-benzoyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 133134019 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-[(1R,5S)-3-benzoyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-4-phenylbutan-1-one |
| SMILES | O=C(c1ccccc1)N1C[C@H]2CC[C@@H](C1)N(C(=O)CCCc1ccccc1)C2 |
| InChI | InChI=1S/C24H28N2O2/c27-23(13-7-10-19-8-3-1-4-9-19)26-17-20-14-15-22(26)18-25(16-20)24(28)21-11-5-2-6-12-21/h1-6,8-9,11-12,20,22H,7,10,13-18H2/t20-,22+/m1/s1 |
| InChIKey | QOSRVYSMYSPRLD-IRLDBZIGSA-N |
| XLogP | 3.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |