C22H33N3O2 — CID 72878379
N-[4-oxo-4-[(1S,5R)-3-(3-phenylpropyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]butyl]acetamide (PubChem CID 72878379) has the molecular formula C22H33N3O2 and a molecular weight of 371.52 g/mol. Its IUPAC name is N-[4-oxo-4-[(1S,5R)-3-(3-phenylpropyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]butyl]acetamide.
| Compound Name | N-[4-oxo-4-[(1S,5R)-3-(3-phenylpropyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]butyl]acetamide |
|---|---|
| PubChem CID | 72878379 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-[4-oxo-4-[(1S,5R)-3-(3-phenylpropyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]butyl]acetamide |
| SMILES | CC(=O)NCCCC(=O)N1C[C@H]2CC[C@@H]1CN(CCCc1ccccc1)C2 |
| InChI | InChI=1S/C22H33N3O2/c1-18(26)23-13-5-10-22(27)25-16-20-11-12-21(25)17-24(15-20)14-6-9-19-7-3-2-4-8-19/h2-4,7-8,20-21H,5-6,9-17H2,1H3,(H,23,26)/t20-,21+/m0/s1 |
| InChIKey | HRDFHORRMBASMB-LEWJYISDSA-N |
| XLogP | 2.46 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|