C21H31FN4O — CID 133130403
1-[(3aR,6aR)-5-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-methylbutan-1-one (PubChem CID 133130403) has the molecular formula C21H31FN4O and a molecular weight of 374.50 g/mol. Its IUPAC name is 1-[(3aR,6aR)-5-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(3aR,6aR)-5-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 133130403 |
| Molecular Formula | C21H31FN4O |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 1-[(3aR,6aR)-5-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CC[C@@H]2CN(CC3CNNC3c3ccc(F)cc3)C[C@@H]21 |
| InChI | InChI=1S/C21H31FN4O/c1-14(2)9-20(27)26-8-7-16-11-25(13-19(16)26)12-17-10-23-24-21(17)15-3-5-18(22)6-4-15/h3-6,14,16-17,19,21,23-24H,7-13H2,1-2H3/t16-,17?,19+,21?/m1/s1 |
| InChIKey | UJJBMKXKSHJKRX-XVJXYWBYSA-N |
| XLogP | 2.17 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |