C18H27ClN4O — CID 75594509
2-[1-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]piperidin-4-yl]-N-methylacetamide (PubChem CID 75594509) has the molecular formula C18H27ClN4O and a molecular weight of 350.89 g/mol. Its IUPAC name is 2-[1-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]piperidin-4-yl]-N-methylacetamide.
| Compound Name | 2-[1-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]piperidin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 75594509 |
| Molecular Formula | C18H27ClN4O |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-[1-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]piperidin-4-yl]-N-methylacetamide |
| SMILES | CNC(=O)CC1CCN(CC2CNNC2c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H27ClN4O/c1-20-17(24)10-13-6-8-23(9-7-13)12-15-11-21-22-18(15)14-2-4-16(19)5-3-14/h2-5,13,15,18,21-22H,6-12H2,1H3,(H,20,24) |
| InChIKey | NZFWHNVIKLICKR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |