C18H28N4 — CID 133130568
(3aR,6aR)-5-[(2-cyclohexylpyrimidin-5-yl)methyl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 133130568) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is (3aR,6aR)-5-[(2-cyclohexylpyrimidin-5-yl)methyl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | (3aR,6aR)-5-[(2-cyclohexylpyrimidin-5-yl)methyl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 133130568 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | (3aR,6aR)-5-[(2-cyclohexylpyrimidin-5-yl)methyl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | CN1CC[C@@H]2CN(Cc3cnc(C4CCCCC4)nc3)C[C@@H]21 |
| InChI | InChI=1S/C18H28N4/c1-21-8-7-16-12-22(13-17(16)21)11-14-9-19-18(20-10-14)15-5-3-2-4-6-15/h9-10,15-17H,2-8,11-13H2,1H3/t16-,17+/m1/s1 |
| InChIKey | FDKSGVZAOQPKCZ-SJORKVTESA-N |
| XLogP | 2.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |