C21H31N5O — CID 99946557
(S)-[1-[(2-cyclohexylpyrimidin-5-yl)methyl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol (PubChem CID 99946557) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is (S)-[1-[(2-cyclohexylpyrimidin-5-yl)methyl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol.
| Compound Name | (S)-[1-[(2-cyclohexylpyrimidin-5-yl)methyl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol |
|---|---|
| PubChem CID | 99946557 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | (S)-[1-[(2-cyclohexylpyrimidin-5-yl)methyl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol |
| SMILES | Cn1ccnc1[C@@H](O)C1CCN(Cc2cnc(C3CCCCC3)nc2)CC1 |
| InChI | InChI=1S/C21H31N5O/c1-25-12-9-22-21(25)19(27)17-7-10-26(11-8-17)15-16-13-23-20(24-14-16)18-5-3-2-4-6-18/h9,12-14,17-19,27H,2-8,10-11,15H2,1H3/t19-/m0/s1 |
| InChIKey | DNRKJKSQOBCBJF-IBGZPJMESA-N |
| XLogP | 3.20 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |