C21H26N4O2S — CID 133131233
(3R,4R)-1-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrolidin-3-ol (PubChem CID 133131233) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is (3R,4R)-1-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 133131233 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (3R,4R)-1-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrolidin-3-ol |
| SMILES | OCC#Cc1csc(CN2C[C@@H](O)[C@H](N3CCN(c4ccccn4)CC3)C2)c1 |
| InChI | InChI=1S/C21H26N4O2S/c26-11-3-4-17-12-18(28-16-17)13-23-14-19(20(27)15-23)24-7-9-25(10-8-24)21-5-1-2-6-22-21/h1-2,5-6,12,16,19-20,26-27H,7-11,13-15H2/t19-,20-/m1/s1 |
| InChIKey | QUJMXPVVKSPYOV-WOJBJXKFSA-N |
| XLogP | 0.85 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|