C28H32N2O4 — CID 133132039
N-[(1S,2S)-1'-[(1S,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]-2-ethoxyspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]furan-2-carboxamide (PubChem CID 133132039) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is N-[(1S,2S)-1'-[(1S,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]-2-ethoxyspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]furan-2-carboxamide.
| Compound Name | N-[(1S,2S)-1'-[(1S,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]-2-ethoxyspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 133132039 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | N-[(1S,2S)-1'-[(1S,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]-2-ethoxyspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]furan-2-carboxamide |
| SMILES | CCO[C@@H]1[C@@H](NC(=O)c2ccco2)c2ccccc2C12CCN(C(=O)[C@@H]1C[C@H]3C=C[C@@H]1C3)CC2 |
| InChI | InChI=1S/C28H32N2O4/c1-2-33-25-24(29-26(31)23-8-5-15-34-23)20-6-3-4-7-22(20)28(25)11-13-30(14-12-28)27(32)21-17-18-9-10-19(21)16-18/h3-10,15,18-19,21,24-25H,2,11-14,16-17H2,1H3,(H,29,31)/t18-,19+,21+,24-,25+/m0/s1 |
| InChIKey | XYRQRNYHEDDRAY-STUFIMANSA-N |
| XLogP | 4.24 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|