C24H32N2O3S — CID 42190119
N-[(1R,2R)-2-ethoxy-1'-(3-methylsulfanylpropyl)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]furan-2-carboxamide (PubChem CID 42190119) has the molecular formula C24H32N2O3S and a molecular weight of 428.60 g/mol. Its IUPAC name is N-[(1R,2R)-2-ethoxy-1'-(3-methylsulfanylpropyl)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]furan-2-carboxamide.
| Compound Name | N-[(1R,2R)-2-ethoxy-1'-(3-methylsulfanylpropyl)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42190119 |
| Molecular Formula | C24H32N2O3S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-[(1R,2R)-2-ethoxy-1'-(3-methylsulfanylpropyl)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]furan-2-carboxamide |
| SMILES | CCO[C@H]1[C@H](NC(=O)c2ccco2)c2ccccc2C12CCN(CCCSC)CC2 |
| InChI | InChI=1S/C24H32N2O3S/c1-3-28-22-21(25-23(27)20-10-6-16-29-20)18-8-4-5-9-19(18)24(22)11-14-26(15-12-24)13-7-17-30-2/h4-6,8-10,16,21-22H,3,7,11-15,17H2,1-2H3,(H,25,27)/t21-,22+/m1/s1 |
| InChIKey | WGDSKIWDHKSCFV-YADHBBJMSA-N |
| XLogP | 4.26 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|