C28H42N2O4 — CID 133132407
N-[(1S,2S)-1'-(2-cyclohexylacetyl)-2-(2-methoxyethoxy)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-methylpropanamide (PubChem CID 133132407) has the molecular formula C28H42N2O4 and a molecular weight of 470.65 g/mol. Its IUPAC name is N-[(1S,2S)-1'-(2-cyclohexylacetyl)-2-(2-methoxyethoxy)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-methylpropanamide.
| Compound Name | N-[(1S,2S)-1'-(2-cyclohexylacetyl)-2-(2-methoxyethoxy)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 133132407 |
| Molecular Formula | C28H42N2O4 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | N-[(1S,2S)-1'-(2-cyclohexylacetyl)-2-(2-methoxyethoxy)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]-2-methylpropanamide |
| SMILES | COCCO[C@@H]1[C@@H](NC(=O)C(C)C)c2ccccc2C12CCN(C(=O)CC1CCCCC1)CC2 |
| InChI | InChI=1S/C28H42N2O4/c1-20(2)27(32)29-25-22-11-7-8-12-23(22)28(26(25)34-18-17-33-3)13-15-30(16-14-28)24(31)19-21-9-5-4-6-10-21/h7-8,11-12,20-21,25-26H,4-6,9-10,13-19H2,1-3H3,(H,29,32)/t25-,26+/m0/s1 |
| InChIKey | ABUZOQKRRCJSNZ-IZZNHLLZSA-N |
| XLogP | 4.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|