C17H21NO7 — CID 133132846
(3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(2-methoxyethoxy)acetyl]pyrrolidine-3-carboxylic acid (PubChem CID 133132846) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is (3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(2-methoxyethoxy)acetyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(2-methoxyethoxy)acetyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 133132846 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(2-methoxyethoxy)acetyl]pyrrolidine-3-carboxylic acid |
| SMILES | COCCOCC(=O)N1C[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C17H21NO7/c1-22-4-5-23-9-16(19)18-7-12(13(8-18)17(20)21)11-2-3-14-15(6-11)25-10-24-14/h2-3,6,12-13H,4-5,7-10H2,1H3,(H,20,21)/t12-,13+/m1/s1 |
| InChIKey | SPOFBVGTSVIUOW-OLZOCXBDSA-N |
| XLogP | 0.70 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|