C13H18Cl2N2O — CID 133133036
(3R,4S)-1-[(2,3-dichlorophenyl)methyl]-3-methoxypiperidin-4-amine (PubChem CID 133133036) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is (3R,4S)-1-[(2,3-dichlorophenyl)methyl]-3-methoxypiperidin-4-amine.
| Compound Name | (3R,4S)-1-[(2,3-dichlorophenyl)methyl]-3-methoxypiperidin-4-amine |
|---|---|
| PubChem CID | 133133036 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (3R,4S)-1-[(2,3-dichlorophenyl)methyl]-3-methoxypiperidin-4-amine |
| SMILES | CO[C@@H]1CN(Cc2cccc(Cl)c2Cl)CC[C@@H]1N |
| InChI | InChI=1S/C13H18Cl2N2O/c1-18-12-8-17(6-5-11(12)16)7-9-3-2-4-10(14)13(9)15/h2-4,11-12H,5-8,16H2,1H3/t11-,12+/m0/s1 |
| InChIKey | JDYWZJRZOSXLJH-NWDGAFQWSA-N |
| XLogP | 2.54 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |