C13H16Cl2N2O — CID 26458106
(3S)-1-[(2,3-dichlorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 26458106) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is (3S)-1-[(2,3-dichlorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[(2,3-dichlorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 26458106 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (3S)-1-[(2,3-dichlorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN(Cc2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C13H16Cl2N2O/c14-11-5-1-3-9(12(11)15)7-17-6-2-4-10(8-17)13(16)18/h1,3,5,10H,2,4,6-8H2,(H2,16,18)/t10-/m0/s1 |
| InChIKey | HKTANZFQTNNOIG-JTQLQIEISA-N |
| XLogP | 2.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |