C20H18ClN3O2 — CID 133133594
[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[8-chloro-2-(furan-2-yl)quinolin-4-yl]methanone (PubChem CID 133133594) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is [(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[8-chloro-2-(furan-2-yl)quinolin-4-yl]methanone.
| Compound Name | [(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[8-chloro-2-(furan-2-yl)quinolin-4-yl]methanone |
|---|---|
| PubChem CID | 133133594 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[8-chloro-2-(furan-2-yl)quinolin-4-yl]methanone |
| SMILES | O=C(c1cc(-c2ccco2)nc2c(Cl)cccc12)N1CC[C@@H]2CNC[C@@H]21 |
| InChI | InChI=1S/C20H18ClN3O2/c21-15-4-1-3-13-14(9-16(23-19(13)15)18-5-2-8-26-18)20(25)24-7-6-12-10-22-11-17(12)24/h1-5,8-9,12,17,22H,6-7,10-11H2/t12-,17+/m1/s1 |
| InChIKey | ACYDPSZKYZNUAH-PXAZEXFGSA-N |
| XLogP | 3.58 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |