C20H28N2O5S — CID 133136866
[(3aS,8aS)-2-[(3-methoxyphenyl)methyl]-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-(oxolan-2-yl)methanone (PubChem CID 133136866) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is [(3aS,8aS)-2-[(3-methoxyphenyl)methyl]-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-(oxolan-2-yl)methanone.
| Compound Name | [(3aS,8aS)-2-[(3-methoxyphenyl)methyl]-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 133136866 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [(3aS,8aS)-2-[(3-methoxyphenyl)methyl]-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-(oxolan-2-yl)methanone |
| SMILES | COc1cccc(CN2C[C@@H]3CCN(C(=O)C4CCCO4)CC[C@@H]3S2(=O)=O)c1 |
| InChI | InChI=1S/C20H28N2O5S/c1-26-17-5-2-4-15(12-17)13-22-14-16-7-9-21(10-8-19(16)28(22,24)25)20(23)18-6-3-11-27-18/h2,4-5,12,16,18-19H,3,6-11,13-14H2,1H3/t16-,18?,19-/m0/s1 |
| InChIKey | OMFRDXJNTBJDHW-NMBLWERJSA-N |
| XLogP | 1.63 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |