C23H28N2O5S — CID 97440903
[(3aR,8aR)-2-[(3-methoxyphenyl)methyl]-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-(3-methoxyphenyl)methanone (PubChem CID 97440903) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is [(3aR,8aR)-2-[(3-methoxyphenyl)methyl]-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [(3aR,8aR)-2-[(3-methoxyphenyl)methyl]-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 97440903 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [(3aR,8aR)-2-[(3-methoxyphenyl)methyl]-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(CN2C[C@H]3CCN(C(=O)c4cccc(OC)c4)CC[C@H]3S2(=O)=O)c1 |
| InChI | InChI=1S/C23H28N2O5S/c1-29-20-7-3-5-17(13-20)15-25-16-19-9-11-24(12-10-22(19)31(25,27)28)23(26)18-6-4-8-21(14-18)30-2/h3-8,13-14,19,22H,9-12,15-16H2,1-2H3/t19-,22-/m1/s1 |
| InChIKey | KZKRSMOQDNZWNJ-DENIHFKCSA-N |
| XLogP | 2.77 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |