C17H18N2O — CID 133138224
3-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl]benzonitrile (PubChem CID 133138224) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl]benzonitrile.
| Compound Name | 3-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 133138224 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 3-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl]benzonitrile |
| SMILES | CC1=CC[C@H]2CN(C(=O)c3cccc(C#N)c3)C[C@H]2C1 |
| InChI | InChI=1S/C17H18N2O/c1-12-5-6-15-10-19(11-16(15)7-12)17(20)14-4-2-3-13(8-14)9-18/h2-5,8,15-16H,6-7,10-11H2,1H3/t15-,16+/m0/s1 |
| InChIKey | GZLNGALLZCDLCU-JKSUJKDBSA-N |
| XLogP | 2.99 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|