C18H23NO2S — CID 91791890
[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[4-(2-hydroxyethylsulfanyl)phenyl]methanone (PubChem CID 91791890) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[4-(2-hydroxyethylsulfanyl)phenyl]methanone.
| Compound Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[4-(2-hydroxyethylsulfanyl)phenyl]methanone |
|---|---|
| PubChem CID | 91791890 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[4-(2-hydroxyethylsulfanyl)phenyl]methanone |
| SMILES | CC1=CC[C@@H]2CN(C(=O)c3ccc(SCCO)cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C18H23NO2S/c1-13-2-3-15-11-19(12-16(15)10-13)18(21)14-4-6-17(7-5-14)22-9-8-20/h2,4-7,15-16,20H,3,8-12H2,1H3/t15-,16+/m1/s1 |
| InChIKey | SIYIWLMAFJZPHG-CVEARBPZSA-N |
| XLogP | 3.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|