C16H18N4O — CID 56863896
[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-pyrazolo[1,5-a]pyrimidin-2-ylmethanone (PubChem CID 56863896) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-pyrazolo[1,5-a]pyrimidin-2-ylmethanone.
| Compound Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-pyrazolo[1,5-a]pyrimidin-2-ylmethanone |
|---|---|
| PubChem CID | 56863896 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-pyrazolo[1,5-a]pyrimidin-2-ylmethanone |
| SMILES | CC1=CC[C@@H]2CN(C(=O)c3cc4ncccn4n3)C[C@@H]2C1 |
| InChI | InChI=1S/C16H18N4O/c1-11-3-4-12-9-19(10-13(12)7-11)16(21)14-8-15-17-5-2-6-20(15)18-14/h2-3,5-6,8,12-13H,4,7,9-10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | XDKQIFDOEIWYRV-OLZOCXBDSA-N |
| XLogP | 2.16 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|