C22H24N4O — CID 56743412
[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[5-(indol-1-ylmethyl)-1H-pyrazol-3-yl]methanone (PubChem CID 56743412) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[5-(indol-1-ylmethyl)-1H-pyrazol-3-yl]methanone.
| Compound Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[5-(indol-1-ylmethyl)-1H-pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 56743412 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[5-(indol-1-ylmethyl)-1H-pyrazol-3-yl]methanone |
| SMILES | CC1=CC[C@@H]2CN(C(=O)c3cc(Cn4ccc5ccccc54)[nH]n3)C[C@@H]2C1 |
| InChI | InChI=1S/C22H24N4O/c1-15-6-7-17-12-26(13-18(17)10-15)22(27)20-11-19(23-24-20)14-25-9-8-16-4-2-3-5-21(16)25/h2-6,8-9,11,17-18H,7,10,12-14H2,1H3,(H,23,24)/t17-,18+/m1/s1 |
| InChIKey | DFPQBQOTUOGSRV-MSOLQXFVSA-N |
| XLogP | 3.84 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|