C17H19N5O — CID 133111868
[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[2-(1,2,4-triazol-4-yl)-4-pyridinyl]methanone (PubChem CID 133111868) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is [(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[2-(1,2,4-triazol-4-yl)-4-pyridinyl]methanone.
| Compound Name | [(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[2-(1,2,4-triazol-4-yl)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 133111868 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | [(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[2-(1,2,4-triazol-4-yl)-4-pyridinyl]methanone |
| SMILES | CC1=CC[C@H]2CN(C(=O)c3ccnc(-n4cnnc4)c3)C[C@H]2C1 |
| InChI | InChI=1S/C17H19N5O/c1-12-2-3-14-8-21(9-15(14)6-12)17(23)13-4-5-18-16(7-13)22-10-19-20-11-22/h2,4-5,7,10-11,14-15H,3,6,8-9H2,1H3/t14-,15+/m0/s1 |
| InChIKey | BZXWIEGJNCQDEZ-LSDHHAIUSA-N |
| XLogP | 2.09 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|