C15H24N4O3 — CID 133140231
N-[(3R,3aS,7aS)-1-(2-methoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylimidazole-2-carboxamide (PubChem CID 133140231) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(3R,3aS,7aS)-1-(2-methoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylimidazole-2-carboxamide.
| Compound Name | N-[(3R,3aS,7aS)-1-(2-methoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylimidazole-2-carboxamide |
|---|---|
| PubChem CID | 133140231 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | N-[(3R,3aS,7aS)-1-(2-methoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylimidazole-2-carboxamide |
| SMILES | COCCN1C[C@@H](NC(=O)c2nccn2C)[C@@H]2OCCC[C@@H]21 |
| InChI | InChI=1S/C15H24N4O3/c1-18-6-5-16-14(18)15(20)17-11-10-19(7-9-21-2)12-4-3-8-22-13(11)12/h5-6,11-13H,3-4,7-10H2,1-2H3,(H,17,20)/t11-,12+,13+/m1/s1 |
| InChIKey | LCPYOENLTFGKLQ-AGIUHOORSA-N |
| XLogP | 0.03 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |