C19H29NO5S — CID 133140359
4-(2-methoxyethyl)-8-(2-methoxy-4-methylphenyl)sulfonyl-1-oxa-8-azaspiro[4.5]decane (PubChem CID 133140359) has the molecular formula C19H29NO5S and a molecular weight of 383.51 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-8-(2-methoxy-4-methylphenyl)sulfonyl-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | 4-(2-methoxyethyl)-8-(2-methoxy-4-methylphenyl)sulfonyl-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 133140359 |
| Molecular Formula | C19H29NO5S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 4-(2-methoxyethyl)-8-(2-methoxy-4-methylphenyl)sulfonyl-1-oxa-8-azaspiro[4.5]decane |
| SMILES | COCCC1CCOC12CCN(S(=O)(=O)c1ccc(C)cc1OC)CC2 |
| InChI | InChI=1S/C19H29NO5S/c1-15-4-5-18(17(14-15)24-3)26(21,22)20-10-8-19(9-11-20)16(6-12-23-2)7-13-25-19/h4-5,14,16H,6-13H2,1-3H3 |
| InChIKey | VHIHJIVJUHZMBG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |