C17H24FNO4S — CID 124796749
(4S)-8-(2-fluorophenyl)sulfonyl-4-(2-methoxyethyl)-1-oxa-8-azaspiro[4.5]decane (PubChem CID 124796749) has the molecular formula C17H24FNO4S and a molecular weight of 357.45 g/mol. Its IUPAC name is (4S)-8-(2-fluorophenyl)sulfonyl-4-(2-methoxyethyl)-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | (4S)-8-(2-fluorophenyl)sulfonyl-4-(2-methoxyethyl)-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 124796749 |
| Molecular Formula | C17H24FNO4S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (4S)-8-(2-fluorophenyl)sulfonyl-4-(2-methoxyethyl)-1-oxa-8-azaspiro[4.5]decane |
| SMILES | COCC[C@H]1CCOC12CCN(S(=O)(=O)c1ccccc1F)CC2 |
| InChI | InChI=1S/C17H24FNO4S/c1-22-12-6-14-7-13-23-17(14)8-10-19(11-9-17)24(20,21)16-5-3-2-4-15(16)18/h2-5,14H,6-13H2,1H3/t14-/m0/s1 |
| InChIKey | UBRDXTMGZWAWLR-AWEZNQCLSA-N |
| XLogP | 2.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |