C22H31N5O — CID 133141928
(1R,2R,5R,6R,9R,10S,13R)-17-azido-1,5,6-trimethyl-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-trien-6-ol (PubChem CID 133141928) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is (1R,2R,5R,6R,9R,10S,13R)-17-azido-1,5,6-trimethyl-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-trien-6-ol.
| Compound Name | (1R,2R,5R,6R,9R,10S,13R)-17-azido-1,5,6-trimethyl-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-trien-6-ol |
|---|---|
| PubChem CID | 133141928 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | (1R,2R,5R,6R,9R,10S,13R)-17-azido-1,5,6-trimethyl-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-trien-6-ol |
| SMILES | C[C@@]12Cc3cnc(N=[N+]=[N-])nc3C[C@H]1CC[C@H]1[C@H]2CC[C@]2(C)[C@@H]1CC[C@@]2(C)O |
| InChI | InChI=1S/C22H31N5O/c1-20-11-13-12-24-19(26-27-23)25-18(13)10-14(20)4-5-15-16(20)6-8-21(2)17(15)7-9-22(21,3)28/h12,14-17,28H,4-11H2,1-3H3/t14-,15+,16-,17-,20-,21-,22-/m1/s1 |
| InChIKey | NZGRZPZDCQETMU-DPMGHTSRSA-N |
| XLogP | 5.13 |
| TPSA | 94.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|