C18H23ClN4O3 — CID 133142253
7-[2-(4-chlorophenoxy)ethyl]-N-(2-methoxyethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-5-carboxamide (PubChem CID 133142253) has the molecular formula C18H23ClN4O3 and a molecular weight of 378.86 g/mol. Its IUPAC name is 7-[2-(4-chlorophenoxy)ethyl]-N-(2-methoxyethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-5-carboxamide.
| Compound Name | 7-[2-(4-chlorophenoxy)ethyl]-N-(2-methoxyethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-5-carboxamide |
|---|---|
| PubChem CID | 133142253 |
| Molecular Formula | C18H23ClN4O3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 7-[2-(4-chlorophenoxy)ethyl]-N-(2-methoxyethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-5-carboxamide |
| SMILES | COCCNC(=O)C1CN(CCOc2ccc(Cl)cc2)Cc2cncn21 |
| InChI | InChI=1S/C18H23ClN4O3/c1-25-8-6-21-18(24)17-12-22(11-15-10-20-13-23(15)17)7-9-26-16-4-2-14(19)3-5-16/h2-5,10,13,17H,6-9,11-12H2,1H3,(H,21,24) |
| InChIKey | CBNSVPFSYUXXOC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|