C22H28N2O — CID 133143871
N-[(E)-1-(4-tert-butylphenyl)ethylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 133143871) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is N-[(E)-1-(4-tert-butylphenyl)ethylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(E)-1-(4-tert-butylphenyl)ethylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 133143871 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-[(E)-1-(4-tert-butylphenyl)ethylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | C/C(=N\NC(=O)Cc1ccc(C)cc1C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H28N2O/c1-15-7-8-19(16(2)13-15)14-21(25)24-23-17(3)18-9-11-20(12-10-18)22(4,5)6/h7-13H,14H2,1-6H3,(H,24,25)/b23-17+ |
| InChIKey | HEDWYCRYUNNOTQ-HAVVHWLPSA-N |
| XLogP | 4.68 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|