C22H28N2O — CID 133170971
N-[(E)-1-(3,5-diethylphenyl)ethylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 133170971) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is N-[(E)-1-(3,5-diethylphenyl)ethylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(E)-1-(3,5-diethylphenyl)ethylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 133170971 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-[(E)-1-(3,5-diethylphenyl)ethylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | CCc1cc(CC)cc(/C(C)=N/NC(=O)Cc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C22H28N2O/c1-6-18-11-19(7-2)13-21(12-18)17(5)23-24-22(25)14-20-9-8-15(3)10-16(20)4/h8-13H,6-7,14H2,1-5H3,(H,24,25)/b23-17+ |
| InChIKey | PJKXQRCFXHJMTJ-HAVVHWLPSA-N |
| XLogP | 4.51 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|