C29H31Cl4N3O4S — CID 133147941
N-tert-butyl-2-[(2-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 133147941) has the molecular formula C29H31Cl4N3O4S and a molecular weight of 659.46 g/mol. Its IUPAC name is N-tert-butyl-2-[(2-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-tert-butyl-2-[(2-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133147941 |
| Molecular Formula | C29H31Cl4N3O4S |
| Molecular Weight | 659.46 g/mol |
| Exact Mass | 657.08 |
| IUPAC Name | N-tert-butyl-2-[(2-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CC(C)(C)NC(=O)C(Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C29H31Cl4N3O4S/c1-29(2,3)34-28(38)26(14-19-10-6-5-7-11-19)35(17-20-12-8-9-13-21(20)30)27(37)18-36(41(4,39)40)25-16-23(32)22(31)15-24(25)33/h5-13,15-16,26H,14,17-18H2,1-4H3,(H,34,38) |
| InChIKey | QVDMZKSMHXOGRK-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.46 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|