C28H29Cl4N3O4S — CID 133192523
2-[(2-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide (PubChem CID 133192523) has the molecular formula C28H29Cl4N3O4S and a molecular weight of 645.44 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 133192523 |
| Molecular Formula | C28H29Cl4N3O4S |
| Molecular Weight | 645.44 g/mol |
| Exact Mass | 643.06 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C28H29Cl4N3O4S/c1-18(2)33-28(37)26(13-19-9-5-4-6-10-19)34(16-20-11-7-8-12-21(20)29)27(36)17-35(40(3,38)39)25-15-23(31)22(30)14-24(25)32/h4-12,14-15,18,26H,13,16-17H2,1-3H3,(H,33,37) |
| InChIKey | JMGUBNKZJASAGU-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.44 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|