C26H35N3O6S — CID 133148621
2-[benzyl-[2-(4-morpholin-4-ylsulfonylphenoxy)acetyl]amino]-N-butylpropanamide (PubChem CID 133148621) has the molecular formula C26H35N3O6S and a molecular weight of 517.65 g/mol. Its IUPAC name is 2-[benzyl-[2-(4-morpholin-4-ylsulfonylphenoxy)acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[benzyl-[2-(4-morpholin-4-ylsulfonylphenoxy)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133148621 |
| Molecular Formula | C26H35N3O6S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 2-[benzyl-[2-(4-morpholin-4-ylsulfonylphenoxy)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccccc1)C(=O)COc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H35N3O6S/c1-3-4-14-27-26(31)21(2)29(19-22-8-6-5-7-9-22)25(30)20-35-23-10-12-24(13-11-23)36(32,33)28-15-17-34-18-16-28/h5-13,21H,3-4,14-20H2,1-2H3,(H,27,31) |
| InChIKey | KMUDFCZXMWYEPJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|