C32H38ClN3O6S — CID 133214218
N-butyl-2-[(4-chlorophenyl)methyl-[2-(4-morpholin-4-ylsulfonylphenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 133214218) has the molecular formula C32H38ClN3O6S and a molecular weight of 628.19 g/mol. Its IUPAC name is N-butyl-2-[(4-chlorophenyl)methyl-[2-(4-morpholin-4-ylsulfonylphenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(4-chlorophenyl)methyl-[2-(4-morpholin-4-ylsulfonylphenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133214218 |
| Molecular Formula | C32H38ClN3O6S |
| Molecular Weight | 628.19 g/mol |
| Exact Mass | 627.22 |
| IUPAC Name | N-butyl-2-[(4-chlorophenyl)methyl-[2-(4-morpholin-4-ylsulfonylphenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)COc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C32H38ClN3O6S/c1-2-3-17-34-32(38)30(22-25-7-5-4-6-8-25)36(23-26-9-11-27(33)12-10-26)31(37)24-42-28-13-15-29(16-14-28)43(39,40)35-18-20-41-21-19-35/h4-16,30H,2-3,17-24H2,1H3,(H,34,38) |
| InChIKey | XRJRZOBHHZLFFW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.19 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|