C25H32BrN3O6S — CID 133151972
2-[[2-[1,3-benzodioxol-5-yl(ethylsulfonyl)amino]acetyl]-[(3-bromophenyl)methyl]amino]-N-butylpropanamide (PubChem CID 133151972) has the molecular formula C25H32BrN3O6S and a molecular weight of 582.52 g/mol. Its IUPAC name is 2-[[2-[1,3-benzodioxol-5-yl(ethylsulfonyl)amino]acetyl]-[(3-bromophenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | 2-[[2-[1,3-benzodioxol-5-yl(ethylsulfonyl)amino]acetyl]-[(3-bromophenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133151972 |
| Molecular Formula | C25H32BrN3O6S |
| Molecular Weight | 582.52 g/mol |
| Exact Mass | 581.12 |
| IUPAC Name | 2-[[2-[1,3-benzodioxol-5-yl(ethylsulfonyl)amino]acetyl]-[(3-bromophenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)CN(c1ccc2c(c1)OCO2)S(=O)(=O)CC |
| InChI | InChI=1S/C25H32BrN3O6S/c1-4-6-12-27-25(31)18(3)28(15-19-8-7-9-20(26)13-19)24(30)16-29(36(32,33)5-2)21-10-11-22-23(14-21)35-17-34-22/h7-11,13-14,18H,4-6,12,15-17H2,1-3H3,(H,27,31) |
| InChIKey | GHFNDEDLODOARE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|