C26H35N3O7S — CID 132734400
2-[[2-[1,3-benzodioxol-5-yl(ethylsulfonyl)amino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylpropanamide (PubChem CID 132734400) has the molecular formula C26H35N3O7S and a molecular weight of 533.65 g/mol. Its IUPAC name is 2-[[2-[1,3-benzodioxol-5-yl(ethylsulfonyl)amino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | 2-[[2-[1,3-benzodioxol-5-yl(ethylsulfonyl)amino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 132734400 |
| Molecular Formula | C26H35N3O7S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 2-[[2-[1,3-benzodioxol-5-yl(ethylsulfonyl)amino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(OC)c1)C(=O)CN(c1ccc2c(c1)OCO2)S(=O)(=O)CC |
| InChI | InChI=1S/C26H35N3O7S/c1-5-7-13-27-26(31)19(3)28(16-20-9-8-10-22(14-20)34-4)25(30)17-29(37(32,33)6-2)21-11-12-23-24(15-21)36-18-35-23/h8-12,14-15,19H,5-7,13,16-18H2,1-4H3,(H,27,31) |
| InChIKey | GBJKPEPKJUEVAO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|