C20H24N2O2S — CID 133154497
1-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-ethoxyphenyl)thiourea (PubChem CID 133154497) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 1-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-ethoxyphenyl)thiourea.
| Compound Name | 1-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 133154497 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(3-ethoxyphenyl)thiourea |
| SMILES | CCOc1cccc(NC(=S)NC2CC(C)(C)Oc3ccccc32)c1 |
| InChI | InChI=1S/C20H24N2O2S/c1-4-23-15-9-7-8-14(12-15)21-19(25)22-17-13-20(2,3)24-18-11-6-5-10-16(17)18/h5-12,17H,4,13H2,1-3H3,(H2,21,22,25) |
| InChIKey | VETOXQNVXOXETK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|