C20H24N2O3S — CID 133154763
methyl 2-methyl-3-[1-(4-methylphenoxy)propan-2-ylcarbamothioylamino]benzoate (PubChem CID 133154763) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is methyl 2-methyl-3-[1-(4-methylphenoxy)propan-2-ylcarbamothioylamino]benzoate.
| Compound Name | methyl 2-methyl-3-[1-(4-methylphenoxy)propan-2-ylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 133154763 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | methyl 2-methyl-3-[1-(4-methylphenoxy)propan-2-ylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)NC(C)COc2ccc(C)cc2)c1C |
| InChI | InChI=1S/C20H24N2O3S/c1-13-8-10-16(11-9-13)25-12-14(2)21-20(26)22-18-7-5-6-17(15(18)3)19(23)24-4/h5-11,14H,12H2,1-4H3,(H2,21,22,26) |
| InChIKey | BRHJKIYWRPFHQI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|