C24H24N2O2S — CID 133215791
methyl 2-methyl-3-[[(4-methylphenyl)-phenylmethyl]carbamothioylamino]benzoate (PubChem CID 133215791) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is methyl 2-methyl-3-[[(4-methylphenyl)-phenylmethyl]carbamothioylamino]benzoate.
| Compound Name | methyl 2-methyl-3-[[(4-methylphenyl)-phenylmethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 133215791 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | methyl 2-methyl-3-[[(4-methylphenyl)-phenylmethyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)NC(c2ccccc2)c2ccc(C)cc2)c1C |
| InChI | InChI=1S/C24H24N2O2S/c1-16-12-14-19(15-13-16)22(18-8-5-4-6-9-18)26-24(29)25-21-11-7-10-20(17(21)2)23(27)28-3/h4-15,22H,1-3H3,(H2,25,26,29) |
| InChIKey | IJBDCUHGGXBFEH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|