C22H36N2O4S — CID 133164270
N-(2-ethylhexyl)-4-methoxy-3-(4-methylpiperidine-1-carbonyl)benzenesulfonamide (PubChem CID 133164270) has the molecular formula C22H36N2O4S and a molecular weight of 424.61 g/mol. Its IUPAC name is N-(2-ethylhexyl)-4-methoxy-3-(4-methylpiperidine-1-carbonyl)benzenesulfonamide.
| Compound Name | N-(2-ethylhexyl)-4-methoxy-3-(4-methylpiperidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133164270 |
| Molecular Formula | C22H36N2O4S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | N-(2-ethylhexyl)-4-methoxy-3-(4-methylpiperidine-1-carbonyl)benzenesulfonamide |
| SMILES | CCCCC(CC)CNS(=O)(=O)c1ccc(OC)c(C(=O)N2CCC(C)CC2)c1 |
| InChI | InChI=1S/C22H36N2O4S/c1-5-7-8-18(6-2)16-23-29(26,27)19-9-10-21(28-4)20(15-19)22(25)24-13-11-17(3)12-14-24/h9-10,15,17-18,23H,5-8,11-14,16H2,1-4H3 |
| InChIKey | ZSYQXRGWTABHHU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |